C24H29N5 — CID 19887516
N'-(1-benzylpiperidin-4-yl)-N-cyano-1,2,4,5-tetrahydro-3-benzazepine-3-carboximidamide (PubChem CID 19887516) has the molecular formula C24H29N5 and a molecular weight of 387.53 g/mol. Its IUPAC name is N'-(1-benzylpiperidin-4-yl)-N-cyano-1,2,4,5-tetrahydro-3-benzazepine-3-carboximidamide.
| Compound Name | N'-(1-benzylpiperidin-4-yl)-N-cyano-1,2,4,5-tetrahydro-3-benzazepine-3-carboximidamide |
|---|---|
| PubChem CID | 19887516 |
| Molecular Formula | C24H29N5 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | N'-(1-benzylpiperidin-4-yl)-N-cyano-1,2,4,5-tetrahydro-3-benzazepine-3-carboximidamide |
| SMILES | N#CN/C(=N\C1CCN(Cc2ccccc2)CC1)N1CCc2ccccc2CC1 |
| InChI | InChI=1S/C24H29N5/c25-19-26-24(29-16-10-21-8-4-5-9-22(21)11-17-29)27-23-12-14-28(15-13-23)18-20-6-2-1-3-7-20/h1-9,23H,10-18H2,(H,26,27) |
| InChIKey | NHQKSJSVKGTZNC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|