C15H21N3O3 — CID 19887674
1-[2,3-bis(2-methylprop-2-enoyl)triazinan-1-yl]-2-methylprop-2-en-1-one (PubChem CID 19887674) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[2,3-bis(2-methylprop-2-enoyl)triazinan-1-yl]-2-methylprop-2-en-1-one.
| Compound Name | 1-[2,3-bis(2-methylprop-2-enoyl)triazinan-1-yl]-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 19887674 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-[2,3-bis(2-methylprop-2-enoyl)triazinan-1-yl]-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1CCCN(C(=O)C(=C)C)N1C(=O)C(=C)C |
| InChI | InChI=1S/C15H21N3O3/c1-10(2)13(19)16-8-7-9-17(14(20)11(3)4)18(16)15(21)12(5)6/h1,3,5,7-9H2,2,4,6H3 |
| InChIKey | PVJBNRYFHXPDTF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|