About 2-(ethoxymethyl)buta-2,3-dien-1-amine
2-(ethoxymethyl)buta-2,3-dien-1-amine (PubChem CID 19894398) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is 2-(ethoxymethyl)buta-2,3-dien-1-amine.
Molecular Properties
| Compound Name | 2-(ethoxymethyl)buta-2,3-dien-1-amine |
| PubChem CID | 19894398 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 2-(ethoxymethyl)buta-2,3-dien-1-amine |
| SMILES | C=C=C(CN)COCC |
| InChI | InChI=1S/C7H13NO/c1-3-7(5-8)6-9-4-2/h1,4-6,8H2,2H3 |
| InChIKey | YCZHGIRBAJYHRP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(ethoxymethyl)buta-2,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethoxymethyl)buta-2,3-dien-1-amine?
The IUPAC name of 2-(ethoxymethyl)buta-2,3-dien-1-amine (CID 19894398) is 2-(ethoxymethyl)buta-2,3-dien-1-amine.
What is the SMILES notation for 2-(ethoxymethyl)buta-2,3-dien-1-amine?
The canonical SMILES for 2-(ethoxymethyl)buta-2,3-dien-1-amine is C=C=C(CN)COCC.
What is the InChIKey of 2-(ethoxymethyl)buta-2,3-dien-1-amine?
The InChIKey is YCZHGIRBAJYHRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-3-7(5-8)6-9-4-2/h1,4-6,8H2,2H3.
What are the key properties of 2-(ethoxymethyl)buta-2,3-dien-1-amine?
2-(ethoxymethyl)buta-2,3-dien-1-amine has a molecular weight of 127.19 g/mol, XLogP of 0.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethoxymethyl)buta-2,3-dien-1-amine is sourced from PubChem (CID 19894398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).