C7H13NO — CID 19894398
2-(ethoxymethyl)buta-2,3-dien-1-amine (PubChem CID 19894398) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is 2-(ethoxymethyl)buta-2,3-dien-1-amine.
| Compound Name | 2-(ethoxymethyl)buta-2,3-dien-1-amine |
|---|---|
| PubChem CID | 19894398 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 2-(ethoxymethyl)buta-2,3-dien-1-amine |
| SMILES | C=C=C(CN)COCC |
| InChI | InChI=1S/C7H13NO/c1-3-7(5-8)6-9-4-2/h1,4-6,8H2,2H3 |
| InChIKey | YCZHGIRBAJYHRP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |