C24H30N2O3 — CID 19895757
3a-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]ethyl]-4H-isoindole-1,3-dione (PubChem CID 19895757) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 3a-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]ethyl]-4H-isoindole-1,3-dione.
| Compound Name | 3a-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]ethyl]-4H-isoindole-1,3-dione |
|---|---|
| PubChem CID | 19895757 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 3a-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]ethyl]-4H-isoindole-1,3-dione |
| SMILES | CCCN(CCC12CC=CC=C1C(=O)NC2=O)C1CCc2c(cccc2OC)C1 |
| InChI | InChI=1S/C24H30N2O3/c1-3-14-26(18-10-11-19-17(16-18)7-6-9-21(19)29-2)15-13-24-12-5-4-8-20(24)22(27)25-23(24)28/h4-9,18H,3,10-16H2,1-2H3,(H,25,27,28) |
| InChIKey | LUKQBTLJSNXVSH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|