About triphenylstibane;tripropylstibane
triphenylstibane;tripropylstibane (PubChem CID 19896070) has the molecular formula C27H36Sb2
and a molecular weight of 604.11 g/mol. Its IUPAC name is triphenylstibane;tripropylstibane.
Molecular Properties
| Compound Name | triphenylstibane;tripropylstibane |
| PubChem CID | 19896070 |
| Molecular Formula | C27H36Sb2 |
| Molecular Weight | 604.11 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | triphenylstibane;tripropylstibane |
| SMILES | CCC[Sb](CCC)CCC.c1ccc([Sb](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/3C6H5.3C3H7.2Sb/c3*1-2-4-6-5-3-1;3*1-3-2;;/h3*1-5H;3*1,3H2,2H3;; |
| InChIKey | YLEMNXBUXDIBKU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 604.11 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triphenylstibane;tripropylstibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylstibane;tripropylstibane?
The IUPAC name of triphenylstibane;tripropylstibane (CID 19896070) is triphenylstibane;tripropylstibane.
What is the SMILES notation for triphenylstibane;tripropylstibane?
The canonical SMILES for triphenylstibane;tripropylstibane is CCC[Sb](CCC)CCC.c1ccc([Sb](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenylstibane;tripropylstibane?
The InChIKey is YLEMNXBUXDIBKU-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H5.3C3H7.2Sb/c3*1-2-4-6-5-3-1;3*1-3-2;;/h3*1-5H;3*1,3H2,2H3;;.
What are the key properties of triphenylstibane;tripropylstibane?
triphenylstibane;tripropylstibane has a molecular weight of 604.11 g/mol, XLogP of 5.91, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylstibane;tripropylstibane is sourced from PubChem (CID 19896070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).