C29H30N4O9 — CID 19898762
1,3-dimethyl-6-[4-[2-(4-oxo-2-phenylchromen-6-yl)oxyethyl]piperazin-1-yl]pyrimidine-2,4-dione;oxalic acid (PubChem CID 19898762) has the molecular formula C29H30N4O9 and a molecular weight of 578.58 g/mol. Its IUPAC name is 1,3-dimethyl-6-[4-[2-(4-oxo-2-phenylchromen-6-yl)oxyethyl]piperazin-1-yl]pyrimidine-2,4-dione;oxalic acid.
| Compound Name | 1,3-dimethyl-6-[4-[2-(4-oxo-2-phenylchromen-6-yl)oxyethyl]piperazin-1-yl]pyrimidine-2,4-dione;oxalic acid |
|---|---|
| PubChem CID | 19898762 |
| Molecular Formula | C29H30N4O9 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | 1,3-dimethyl-6-[4-[2-(4-oxo-2-phenylchromen-6-yl)oxyethyl]piperazin-1-yl]pyrimidine-2,4-dione;oxalic acid |
| SMILES | Cn1c(N2CCN(CCOc3ccc4oc(-c5ccccc5)cc(=O)c4c3)CC2)cc(=O)n(C)c1=O.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H28N4O5.C2H2O4/c1-28-25(18-26(33)29(2)27(28)34)31-12-10-30(11-13-31)14-15-35-20-8-9-23-21(16-20)22(32)17-24(36-23)19-6-4-3-5-7-19;3-1(4)2(5)6/h3-9,16-18H,10-15H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | ZVLVULULIPPINI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 164.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|