butyl 3,4-difluoro-2-methylidenebutanoate

C9H14F2O2 — CID 19901772

IUPACbutyl 3,4-difluoro-2-methylidenebutanoate
SMILESC=C(C(=O)OCCCC)C(F)CF
InChIInChI=1S/C9H14F2O2/c1-3-4-5-13-9(12)7(2)8(11)6-10/h8H,2-6H2,1H3
InChIKeyYIBQFNJNCOHJMR-UHFFFAOYSA-N
MW192.20 g/mol
LogP2.19
Rot. Bonds6

About butyl 3,4-difluoro-2-methylidenebutanoate

butyl 3,4-difluoro-2-methylidenebutanoate (PubChem CID 19901772) has the molecular formula C9H14F2O2 and a molecular weight of 192.20 g/mol. Its IUPAC name is butyl 3,4-difluoro-2-methylidenebutanoate.

Molecular Properties

Compound Namebutyl 3,4-difluoro-2-methylidenebutanoate
PubChem CID19901772
Molecular FormulaC9H14F2O2
Molecular Weight192.20 g/mol
Exact Mass192.10
IUPAC Namebutyl 3,4-difluoro-2-methylidenebutanoate
SMILESC=C(C(=O)OCCCC)C(F)CF
InChIInChI=1S/C9H14F2O2/c1-3-4-5-13-9(12)7(2)8(11)6-10/h8H,2-6H2,1H3
InChIKeyYIBQFNJNCOHJMR-UHFFFAOYSA-N
XLogP2.19
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.20
LogP ≤ 52.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze butyl 3,4-difluoro-2-methylidenebutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butyl 3,4-difluoro-2-methylidenebutanoate?
The IUPAC name of butyl 3,4-difluoro-2-methylidenebutanoate (CID 19901772) is butyl 3,4-difluoro-2-methylidenebutanoate.
What is the SMILES notation for butyl 3,4-difluoro-2-methylidenebutanoate?
The canonical SMILES for butyl 3,4-difluoro-2-methylidenebutanoate is C=C(C(=O)OCCCC)C(F)CF.
What is the InChIKey of butyl 3,4-difluoro-2-methylidenebutanoate?
The InChIKey is YIBQFNJNCOHJMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O2/c1-3-4-5-13-9(12)7(2)8(11)6-10/h8H,2-6H2,1H3.
What are the key properties of butyl 3,4-difluoro-2-methylidenebutanoate?
butyl 3,4-difluoro-2-methylidenebutanoate has a molecular weight of 192.20 g/mol, XLogP of 2.19, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3,4-difluoro-2-methylidenebutanoate is sourced from PubChem (CID 19901772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).