About 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde
5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde (PubChem CID 19904425) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde.
Molecular Properties
| Compound Name | 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde |
| PubChem CID | 19904425 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde |
| SMILES | CC1(C)OCC(C=O)(C2CCCCC2)CO1 |
| InChI | InChI=1S/C13H22O3/c1-12(2)15-9-13(8-14,10-16-12)11-6-4-3-5-7-11/h8,11H,3-7,9-10H2,1-2H3 |
| InChIKey | OMBSQKQZALCXSO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde?
The IUPAC name of 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde (CID 19904425) is 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde.
What is the SMILES notation for 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde?
The canonical SMILES for 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde is CC1(C)OCC(C=O)(C2CCCCC2)CO1.
What is the InChIKey of 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde?
The InChIKey is OMBSQKQZALCXSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3/c1-12(2)15-9-13(8-14,10-16-12)11-6-4-3-5-7-11/h8,11H,3-7,9-10H2,1-2H3.
What are the key properties of 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde?
5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde has a molecular weight of 226.32 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-2,2-dimethyl-1,3-dioxane-5-carbaldehyde is sourced from PubChem (CID 19904425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).