C10H18N2 — CID 19908224
4-methyl-1,2,3,5,7,8,9,9a-octahydro-1,4-benzodiazepine (PubChem CID 19908224) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 4-methyl-1,2,3,5,7,8,9,9a-octahydro-1,4-benzodiazepine.
| Compound Name | 4-methyl-1,2,3,5,7,8,9,9a-octahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 19908224 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 4-methyl-1,2,3,5,7,8,9,9a-octahydro-1,4-benzodiazepine |
| SMILES | CN1CCNC2CCCC=C2C1 |
| InChI | InChI=1S/C10H18N2/c1-12-7-6-11-10-5-3-2-4-9(10)8-12/h4,10-11H,2-3,5-8H2,1H3 |
| InChIKey | VUVMPVLCOLYGCW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|