About pyrazol-1-ylurea
pyrazol-1-ylurea (PubChem CID 19911942) has the molecular formula C4H6N4O
and a molecular weight of 126.12 g/mol. Its IUPAC name is pyrazol-1-ylurea.
Molecular Properties
| Compound Name | pyrazol-1-ylurea |
| PubChem CID | 19911942 |
| Molecular Formula | C4H6N4O |
| Molecular Weight | 126.12 g/mol |
| Exact Mass | 126.05 |
| IUPAC Name | pyrazol-1-ylurea |
| SMILES | NC(=O)Nn1cccn1 |
| InChI | InChI=1S/C4H6N4O/c5-4(9)7-8-3-1-2-6-8/h1-3H,(H3,5,7,9) |
| InChIKey | LCXHGYDKTPUJPT-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.12 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazol-1-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazol-1-ylurea?
The IUPAC name of pyrazol-1-ylurea (CID 19911942) is pyrazol-1-ylurea.
What is the SMILES notation for pyrazol-1-ylurea?
The canonical SMILES for pyrazol-1-ylurea is NC(=O)Nn1cccn1.
What is the InChIKey of pyrazol-1-ylurea?
The InChIKey is LCXHGYDKTPUJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O/c5-4(9)7-8-3-1-2-6-8/h1-3H,(H3,5,7,9).
What are the key properties of pyrazol-1-ylurea?
pyrazol-1-ylurea has a molecular weight of 126.12 g/mol, XLogP of -0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazol-1-ylurea is sourced from PubChem (CID 19911942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).