C13H14O5 — CID 19913878
methyl 5-(2-hydroxy-4-methylphenyl)-3,5-dioxopentanoate (PubChem CID 19913878) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is methyl 5-(2-hydroxy-4-methylphenyl)-3,5-dioxopentanoate.
| Compound Name | methyl 5-(2-hydroxy-4-methylphenyl)-3,5-dioxopentanoate |
|---|---|
| PubChem CID | 19913878 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | methyl 5-(2-hydroxy-4-methylphenyl)-3,5-dioxopentanoate |
| SMILES | COC(=O)CC(=O)CC(=O)c1ccc(C)cc1O |
| InChI | InChI=1S/C13H14O5/c1-8-3-4-10(11(15)5-8)12(16)6-9(14)7-13(17)18-2/h3-5,15H,6-7H2,1-2H3 |
| InChIKey | QKAZTTRVBXQATJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|