C26H28ClN3O2 — CID 19917234
1-[4-(4-chlorophenyl)piperazin-1-yl]-3-[(E)-1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino]oxypropan-2-ol (PubChem CID 19917234) has the molecular formula C26H28ClN3O2 and a molecular weight of 449.98 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-[(E)-1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino]oxypropan-2-ol.
| Compound Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-[(E)-1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino]oxypropan-2-ol |
|---|---|
| PubChem CID | 19917234 |
| Molecular Formula | C26H28ClN3O2 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-[(E)-1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino]oxypropan-2-ol |
| SMILES | OC(CO/N=C1\CCc2c1ccc1ccccc21)CN1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H28ClN3O2/c27-20-6-8-21(9-7-20)30-15-13-29(14-16-30)17-22(31)18-32-28-26-12-11-24-23-4-2-1-3-19(23)5-10-25(24)26/h1-10,22,31H,11-18H2/b28-26+ |
| InChIKey | MVCWVJSDCVSSPJ-BYCLXTJYSA-N |
| XLogP | 4.34 |
| TPSA | 48.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|