C28H32ClN3O2 — CID 139652531
1-[4-[(4-chlorophenyl)methyl]-2-methylpiperazin-1-yl]-3-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxypropan-2-ol (PubChem CID 139652531) has the molecular formula C28H32ClN3O2 and a molecular weight of 478.04 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)methyl]-2-methylpiperazin-1-yl]-3-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxypropan-2-ol.
| Compound Name | 1-[4-[(4-chlorophenyl)methyl]-2-methylpiperazin-1-yl]-3-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxypropan-2-ol |
|---|---|
| PubChem CID | 139652531 |
| Molecular Formula | C28H32ClN3O2 |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)methyl]-2-methylpiperazin-1-yl]-3-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxypropan-2-ol |
| SMILES | CC1CN(Cc2ccc(Cl)cc2)CCN1CC(O)CON=C1CCc2c1ccc1ccccc21 |
| InChI | InChI=1S/C28H32ClN3O2/c1-20-16-31(17-21-6-9-23(29)10-7-21)14-15-32(20)18-24(33)19-34-30-28-13-12-26-25-5-3-2-4-22(25)8-11-27(26)28/h2-11,20,24,33H,12-19H2,1H3 |
| InChIKey | ZVMBRCHNHHBJQI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 48.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|