C17H14N4O4S — CID 19918439
methyl (Z)-3-methoxy-2-[2-[(3-pyrazin-2-yl-1,2,4-thiadiazol-5-yl)oxy]phenyl]prop-2-enoate (PubChem CID 19918439) has the molecular formula C17H14N4O4S and a molecular weight of 370.39 g/mol. Its IUPAC name is methyl (Z)-3-methoxy-2-[2-[(3-pyrazin-2-yl-1,2,4-thiadiazol-5-yl)oxy]phenyl]prop-2-enoate.
| Compound Name | methyl (Z)-3-methoxy-2-[2-[(3-pyrazin-2-yl-1,2,4-thiadiazol-5-yl)oxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19918439 |
| Molecular Formula | C17H14N4O4S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | methyl (Z)-3-methoxy-2-[2-[(3-pyrazin-2-yl-1,2,4-thiadiazol-5-yl)oxy]phenyl]prop-2-enoate |
| SMILES | CO/C=C(\C(=O)OC)c1ccccc1Oc1nc(-c2cnccn2)ns1 |
| InChI | InChI=1S/C17H14N4O4S/c1-23-10-12(16(22)24-2)11-5-3-4-6-14(11)25-17-20-15(21-26-17)13-9-18-7-8-19-13/h3-10H,1-2H3/b12-10- |
| InChIKey | UHHRVAMPRGHTBL-BENRWUELSA-N |
| XLogP | 2.95 |
| TPSA | 96.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|