C12H16BrN3O2 — CID 19919337
6-bromo-8-nitro-N-propyl-1,2,3,4-tetrahydroquinolin-3-amine (PubChem CID 19919337) has the molecular formula C12H16BrN3O2 and a molecular weight of 314.18 g/mol. Its IUPAC name is 6-bromo-8-nitro-N-propyl-1,2,3,4-tetrahydroquinolin-3-amine.
| Compound Name | 6-bromo-8-nitro-N-propyl-1,2,3,4-tetrahydroquinolin-3-amine |
|---|---|
| PubChem CID | 19919337 |
| Molecular Formula | C12H16BrN3O2 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 6-bromo-8-nitro-N-propyl-1,2,3,4-tetrahydroquinolin-3-amine |
| SMILES | CCCNC1CNc2c(cc(Br)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H16BrN3O2/c1-2-3-14-10-5-8-4-9(13)6-11(16(17)18)12(8)15-7-10/h4,6,10,14-15H,2-3,5,7H2,1H3 |
| InChIKey | PJYAMDDRCRZUGJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|