C24H31ClN2O2 — CID 19919936
N-[2-[2-(cyclopropylmethoxy)phenoxy]ethyl]-1-(1H-indol-3-yl)-2-methylpropan-2-amine;hydrochloride (PubChem CID 19919936) has the molecular formula C24H31ClN2O2 and a molecular weight of 414.98 g/mol. Its IUPAC name is N-[2-[2-(cyclopropylmethoxy)phenoxy]ethyl]-1-(1H-indol-3-yl)-2-methylpropan-2-amine;hydrochloride.
| Compound Name | N-[2-[2-(cyclopropylmethoxy)phenoxy]ethyl]-1-(1H-indol-3-yl)-2-methylpropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 19919936 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[2-[2-(cyclopropylmethoxy)phenoxy]ethyl]-1-(1H-indol-3-yl)-2-methylpropan-2-amine;hydrochloride |
| SMILES | CC(C)(Cc1c[nH]c2ccccc12)NCCOc1ccccc1OCC1CC1.Cl |
| InChI | InChI=1S/C24H30N2O2.ClH/c1-24(2,15-19-16-25-21-8-4-3-7-20(19)21)26-13-14-27-22-9-5-6-10-23(22)28-17-18-11-12-18;/h3-10,16,18,25-26H,11-15,17H2,1-2H3;1H |
| InChIKey | VPNYHYHXTUZLPH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|