C24H33ClN2O3 — CID 19919968
3-[2-[[1-(1H-indol-3-yl)-2-methylpropan-2-yl]amino]ethoxy]-4-(2-methylpropoxy)phenol;hydrochloride (PubChem CID 19919968) has the molecular formula C24H33ClN2O3 and a molecular weight of 432.99 g/mol. Its IUPAC name is 3-[2-[[1-(1H-indol-3-yl)-2-methylpropan-2-yl]amino]ethoxy]-4-(2-methylpropoxy)phenol;hydrochloride.
| Compound Name | 3-[2-[[1-(1H-indol-3-yl)-2-methylpropan-2-yl]amino]ethoxy]-4-(2-methylpropoxy)phenol;hydrochloride |
|---|---|
| PubChem CID | 19919968 |
| Molecular Formula | C24H33ClN2O3 |
| Molecular Weight | 432.99 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3-[2-[[1-(1H-indol-3-yl)-2-methylpropan-2-yl]amino]ethoxy]-4-(2-methylpropoxy)phenol;hydrochloride |
| SMILES | CC(C)COc1ccc(O)cc1OCCNC(C)(C)Cc1c[nH]c2ccccc12.Cl |
| InChI | InChI=1S/C24H32N2O3.ClH/c1-17(2)16-29-22-10-9-19(27)13-23(22)28-12-11-26-24(3,4)14-18-15-25-21-8-6-5-7-20(18)21;/h5-10,13,15,17,25-27H,11-12,14,16H2,1-4H3;1H |
| InChIKey | YOSGPHWUPVSYLM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.99 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|