C25H34N2O4S — CID 19919914
2-methyl-N-[2-[2-(2-methylpropoxy)phenoxy]ethyl]-1-(2-methylsulfonyl-1H-indol-3-yl)propan-2-amine (PubChem CID 19919914) has the molecular formula C25H34N2O4S and a molecular weight of 458.62 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-(2-methylpropoxy)phenoxy]ethyl]-1-(2-methylsulfonyl-1H-indol-3-yl)propan-2-amine.
| Compound Name | 2-methyl-N-[2-[2-(2-methylpropoxy)phenoxy]ethyl]-1-(2-methylsulfonyl-1H-indol-3-yl)propan-2-amine |
|---|---|
| PubChem CID | 19919914 |
| Molecular Formula | C25H34N2O4S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 2-methyl-N-[2-[2-(2-methylpropoxy)phenoxy]ethyl]-1-(2-methylsulfonyl-1H-indol-3-yl)propan-2-amine |
| SMILES | CC(C)COc1ccccc1OCCNC(C)(C)Cc1c(S(C)(=O)=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C25H34N2O4S/c1-18(2)17-31-23-13-9-8-12-22(23)30-15-14-26-25(3,4)16-20-19-10-6-7-11-21(19)27-24(20)32(5,28)29/h6-13,18,26-27H,14-17H2,1-5H3 |
| InChIKey | PPOHFKNWEZVWNF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|