C25H32N2O3 — CID 19919967
1-(1H-indol-3-yl)-2-methyl-N-[2-[2-(oxolan-2-ylmethoxy)phenoxy]ethyl]propan-2-amine (PubChem CID 19919967) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-methyl-N-[2-[2-(oxolan-2-ylmethoxy)phenoxy]ethyl]propan-2-amine.
| Compound Name | 1-(1H-indol-3-yl)-2-methyl-N-[2-[2-(oxolan-2-ylmethoxy)phenoxy]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 19919967 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-methyl-N-[2-[2-(oxolan-2-ylmethoxy)phenoxy]ethyl]propan-2-amine |
| SMILES | CC(C)(Cc1c[nH]c2ccccc12)NCCOc1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C25H32N2O3/c1-25(2,16-19-17-26-22-10-4-3-9-21(19)22)27-13-15-29-23-11-5-6-12-24(23)30-18-20-8-7-14-28-20/h3-6,9-12,17,20,26-27H,7-8,13-16,18H2,1-2H3 |
| InChIKey | ZFWZDYWKDXJZLH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 55.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|