C22H23N3O4 — CID 30689433
N'-[2-(1H-indol-3-yl)acetyl]-2-[[(2S)-oxolan-2-yl]methoxy]benzohydrazide (PubChem CID 30689433) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)acetyl]-2-[[(2S)-oxolan-2-yl]methoxy]benzohydrazide.
| Compound Name | N'-[2-(1H-indol-3-yl)acetyl]-2-[[(2S)-oxolan-2-yl]methoxy]benzohydrazide |
|---|---|
| PubChem CID | 30689433 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)acetyl]-2-[[(2S)-oxolan-2-yl]methoxy]benzohydrazide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NNC(=O)c1ccccc1OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C22H23N3O4/c26-21(12-15-13-23-19-9-3-1-7-17(15)19)24-25-22(27)18-8-2-4-10-20(18)29-14-16-6-5-11-28-16/h1-4,7-10,13,16,23H,5-6,11-12,14H2,(H,24,26)(H,25,27)/t16-/m0/s1 |
| InChIKey | DBGNRANACCJPIS-INIZCTEOSA-N |
| XLogP | 2.73 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|