C21H27FNO+ — CID 19921889
ethyl-[6-(4-fluorophenyl)-6-oxohexyl]-methyl-phenylazanium (PubChem CID 19921889) has the molecular formula C21H27FNO+ and a molecular weight of 328.45 g/mol. Its IUPAC name is ethyl-[6-(4-fluorophenyl)-6-oxohexyl]-methyl-phenylazanium.
| Compound Name | ethyl-[6-(4-fluorophenyl)-6-oxohexyl]-methyl-phenylazanium |
|---|---|
| PubChem CID | 19921889 |
| Molecular Formula | C21H27FNO+ |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | ethyl-[6-(4-fluorophenyl)-6-oxohexyl]-methyl-phenylazanium |
| SMILES | CC[N+](C)(CCCCCC(=O)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H27FNO/c1-3-23(2,20-10-6-4-7-11-20)17-9-5-8-12-21(24)18-13-15-19(22)16-14-18/h4,6-7,10-11,13-16H,3,5,8-9,12,17H2,1-2H3/q+1 |
| InChIKey | PZSJNXXAMHPJPS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|