C22H34O5 — CID 19922046
5-[3-(3-ethoxy-3-oxopropyl)-4-(6-hydroxyhexyl)phenyl]pentanoic acid (PubChem CID 19922046) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is 5-[3-(3-ethoxy-3-oxopropyl)-4-(6-hydroxyhexyl)phenyl]pentanoic acid.
| Compound Name | 5-[3-(3-ethoxy-3-oxopropyl)-4-(6-hydroxyhexyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 19922046 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 5-[3-(3-ethoxy-3-oxopropyl)-4-(6-hydroxyhexyl)phenyl]pentanoic acid |
| SMILES | CCOC(=O)CCc1cc(CCCCC(=O)O)ccc1CCCCCCO |
| InChI | InChI=1S/C22H34O5/c1-2-27-22(26)15-14-20-17-18(9-6-7-11-21(24)25)12-13-19(20)10-5-3-4-8-16-23/h12-13,17,23H,2-11,14-16H2,1H3,(H,24,25) |
| InChIKey | KHFCZWUQIYWGMT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|