C31H34ClN3O3 — CID 19922895
2-[1-[2-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]ethyl]-5-methoxy-2-methylindol-3-yl]acetic acid (PubChem CID 19922895) has the molecular formula C31H34ClN3O3 and a molecular weight of 532.08 g/mol. Its IUPAC name is 2-[1-[2-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]ethyl]-5-methoxy-2-methylindol-3-yl]acetic acid.
| Compound Name | 2-[1-[2-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]ethyl]-5-methoxy-2-methylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 19922895 |
| Molecular Formula | C31H34ClN3O3 |
| Molecular Weight | 532.08 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 2-[1-[2-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]ethyl]-5-methoxy-2-methylindol-3-yl]acetic acid |
| SMILES | COc1ccc2c(c1)c(CC(=O)O)c(C)n2CCN1CCN(Cc2ccccc2-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C31H34ClN3O3/c1-22-28(20-31(36)37)29-19-26(38-2)11-12-30(29)35(22)18-17-33-13-15-34(16-14-33)21-24-5-3-4-6-27(24)23-7-9-25(32)10-8-23/h3-12,19H,13-18,20-21H2,1-2H3,(H,36,37) |
| InChIKey | BXQAYJGMBSXWPO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.08 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|