C26H34O4 — CID 19925698
7-[4-[2-hydroxy-2-(5-propan-2-yl-1-benzofuran-2-yl)ethoxy]phenyl]heptan-1-ol (PubChem CID 19925698) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is 7-[4-[2-hydroxy-2-(5-propan-2-yl-1-benzofuran-2-yl)ethoxy]phenyl]heptan-1-ol.
| Compound Name | 7-[4-[2-hydroxy-2-(5-propan-2-yl-1-benzofuran-2-yl)ethoxy]phenyl]heptan-1-ol |
|---|---|
| PubChem CID | 19925698 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 7-[4-[2-hydroxy-2-(5-propan-2-yl-1-benzofuran-2-yl)ethoxy]phenyl]heptan-1-ol |
| SMILES | CC(C)c1ccc2oc(C(O)COc3ccc(CCCCCCCO)cc3)cc2c1 |
| InChI | InChI=1S/C26H34O4/c1-19(2)21-11-14-25-22(16-21)17-26(30-25)24(28)18-29-23-12-9-20(10-13-23)8-6-4-3-5-7-15-27/h9-14,16-17,19,24,27-28H,3-8,15,18H2,1-2H3 |
| InChIKey | OSODDWMNKMXRAP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|