C19H20O4 — CID 170887613
3-[2-[hydroxy-(4-methoxyphenyl)methyl]-1-benzofuran-5-yl]propan-1-ol (PubChem CID 170887613) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-[2-[hydroxy-(4-methoxyphenyl)methyl]-1-benzofuran-5-yl]propan-1-ol.
| Compound Name | 3-[2-[hydroxy-(4-methoxyphenyl)methyl]-1-benzofuran-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 170887613 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 3-[2-[hydroxy-(4-methoxyphenyl)methyl]-1-benzofuran-5-yl]propan-1-ol |
| SMILES | COc1ccc(C(O)c2cc3cc(CCCO)ccc3o2)cc1 |
| InChI | InChI=1S/C19H20O4/c1-22-16-7-5-14(6-8-16)19(21)18-12-15-11-13(3-2-10-20)4-9-17(15)23-18/h4-9,11-12,19-21H,2-3,10H2,1H3 |
| InChIKey | NJTGXUPPPBZARI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |