C19H23FO3 — CID 19925875
3-fluoro-5,5-bis(phenylmethoxy)pentan-1-ol (PubChem CID 19925875) has the molecular formula C19H23FO3 and a molecular weight of 318.39 g/mol. Its IUPAC name is 3-fluoro-5,5-bis(phenylmethoxy)pentan-1-ol.
| Compound Name | 3-fluoro-5,5-bis(phenylmethoxy)pentan-1-ol |
|---|---|
| PubChem CID | 19925875 |
| Molecular Formula | C19H23FO3 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-fluoro-5,5-bis(phenylmethoxy)pentan-1-ol |
| SMILES | OCCC(F)CC(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C19H23FO3/c20-18(11-12-21)13-19(22-14-16-7-3-1-4-8-16)23-15-17-9-5-2-6-10-17/h1-10,18-19,21H,11-15H2 |
| InChIKey | HFPMPCWQURPXBB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|