C14H15Cl2N3O3S — CID 19932171
4-chloro-3-(3-chlorophenyl)sulfonyl-N,N-diethylpyrazole-1-carboxamide (PubChem CID 19932171) has the molecular formula C14H15Cl2N3O3S and a molecular weight of 376.27 g/mol. Its IUPAC name is 4-chloro-3-(3-chlorophenyl)sulfonyl-N,N-diethylpyrazole-1-carboxamide.
| Compound Name | 4-chloro-3-(3-chlorophenyl)sulfonyl-N,N-diethylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 19932171 |
| Molecular Formula | C14H15Cl2N3O3S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 4-chloro-3-(3-chlorophenyl)sulfonyl-N,N-diethylpyrazole-1-carboxamide |
| SMILES | CCN(CC)C(=O)n1cc(Cl)c(S(=O)(=O)c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H15Cl2N3O3S/c1-3-18(4-2)14(20)19-9-12(16)13(17-19)23(21,22)11-7-5-6-10(15)8-11/h5-9H,3-4H2,1-2H3 |
| InChIKey | DLEZMNWQOFJKFD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |