C25H27NO3S2 — CID 19933139
N-[2-oxo-1-(thiophen-3-ylmethylsulfanyl)heptan-3-yl]-3-phenoxybenzamide (PubChem CID 19933139) has the molecular formula C25H27NO3S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is N-[2-oxo-1-(thiophen-3-ylmethylsulfanyl)heptan-3-yl]-3-phenoxybenzamide.
| Compound Name | N-[2-oxo-1-(thiophen-3-ylmethylsulfanyl)heptan-3-yl]-3-phenoxybenzamide |
|---|---|
| PubChem CID | 19933139 |
| Molecular Formula | C25H27NO3S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[2-oxo-1-(thiophen-3-ylmethylsulfanyl)heptan-3-yl]-3-phenoxybenzamide |
| SMILES | CCCCC(NC(=O)c1cccc(Oc2ccccc2)c1)C(=O)CSCc1ccsc1 |
| InChI | InChI=1S/C25H27NO3S2/c1-2-3-12-23(24(27)18-31-17-19-13-14-30-16-19)26-25(28)20-8-7-11-22(15-20)29-21-9-5-4-6-10-21/h4-11,13-16,23H,2-3,12,17-18H2,1H3,(H,26,28) |
| InChIKey | ZOJBBWHKOAVFNO-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |