C20H10Cl5FN2O3 — CID 19934972
2-fluoro-N-[[2,3,6-trichloro-4-(2,4-dichlorophenoxy)phenyl]carbamoyl]benzamide (PubChem CID 19934972) has the molecular formula C20H10Cl5FN2O3 and a molecular weight of 522.57 g/mol. Its IUPAC name is 2-fluoro-N-[[2,3,6-trichloro-4-(2,4-dichlorophenoxy)phenyl]carbamoyl]benzamide.
| Compound Name | 2-fluoro-N-[[2,3,6-trichloro-4-(2,4-dichlorophenoxy)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 19934972 |
| Molecular Formula | C20H10Cl5FN2O3 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 519.91 |
| IUPAC Name | 2-fluoro-N-[[2,3,6-trichloro-4-(2,4-dichlorophenoxy)phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1F)Nc1c(Cl)cc(Oc2ccc(Cl)cc2Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C20H10Cl5FN2O3/c21-9-5-6-14(11(22)7-9)31-15-8-12(23)18(17(25)16(15)24)27-20(30)28-19(29)10-3-1-2-4-13(10)26/h1-8H,(H2,27,28,29,30) |
| InChIKey | XUBDJSNSDQQZDH-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|