C20H12Cl4N2O3 — CID 2805241
2-(2,4-dichlorophenoxy)-N-[(3,5-dichlorophenyl)carbamoyl]benzamide (PubChem CID 2805241) has the molecular formula C20H12Cl4N2O3 and a molecular weight of 470.14 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(3,5-dichlorophenyl)carbamoyl]benzamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(3,5-dichlorophenyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 2805241 |
| Molecular Formula | C20H12Cl4N2O3 |
| Molecular Weight | 470.14 g/mol |
| Exact Mass | 467.96 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(3,5-dichlorophenyl)carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1Oc1ccc(Cl)cc1Cl)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H12Cl4N2O3/c21-11-5-6-18(16(24)10-11)29-17-4-2-1-3-15(17)19(27)26-20(28)25-14-8-12(22)7-13(23)9-14/h1-10H,(H2,25,26,27,28) |
| InChIKey | GQIODIIJEZGWCT-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.14 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |