C28H26ClN7O3 — CID 19935781
[2-butyl-5-chloro-3-[[4-[2-[1-(4-nitrophenyl)tetrazol-5-yl]phenyl]phenyl]methyl]imidazol-4-yl]methanol (PubChem CID 19935781) has the molecular formula C28H26ClN7O3 and a molecular weight of 544.02 g/mol. Its IUPAC name is [2-butyl-5-chloro-3-[[4-[2-[1-(4-nitrophenyl)tetrazol-5-yl]phenyl]phenyl]methyl]imidazol-4-yl]methanol.
| Compound Name | [2-butyl-5-chloro-3-[[4-[2-[1-(4-nitrophenyl)tetrazol-5-yl]phenyl]phenyl]methyl]imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 19935781 |
| Molecular Formula | C28H26ClN7O3 |
| Molecular Weight | 544.02 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | [2-butyl-5-chloro-3-[[4-[2-[1-(4-nitrophenyl)tetrazol-5-yl]phenyl]phenyl]methyl]imidazol-4-yl]methanol |
| SMILES | CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2-c2nnnn2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C28H26ClN7O3/c1-2-3-8-26-30-27(29)25(18-37)34(26)17-19-9-11-20(12-10-19)23-6-4-5-7-24(23)28-31-32-33-35(28)21-13-15-22(16-14-21)36(38)39/h4-7,9-16,37H,2-3,8,17-18H2,1H3 |
| InChIKey | NMBKHIQURWAWJK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.02 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|