C19H35NO4 — CID 19936177
2-(1,2,2,3-tetramethylpiperidin-4-yl)decanedioic acid (PubChem CID 19936177) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is 2-(1,2,2,3-tetramethylpiperidin-4-yl)decanedioic acid.
| Compound Name | 2-(1,2,2,3-tetramethylpiperidin-4-yl)decanedioic acid |
|---|---|
| PubChem CID | 19936177 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 2-(1,2,2,3-tetramethylpiperidin-4-yl)decanedioic acid |
| SMILES | CC1C(C(CCCCCCCC(=O)O)C(=O)O)CCN(C)C1(C)C |
| InChI | InChI=1S/C19H35NO4/c1-14-15(12-13-20(4)19(14,2)3)16(18(23)24)10-8-6-5-7-9-11-17(21)22/h14-16H,5-13H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | QGFBLZNXEFEESN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|