C24H35N5O5 — CID 19945230
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]-3-methylpentanoic acid (PubChem CID 19945230) has the molecular formula C24H35N5O5 and a molecular weight of 473.57 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 19945230 |
| Molecular Formula | C24H35N5O5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(NC(=O)CNC(=O)C(N)Cc1c[nH]c2ccccc12)C(C)C)C(=O)O |
| InChI | InChI=1S/C24H35N5O5/c1-5-14(4)21(24(33)34)29-23(32)20(13(2)3)28-19(30)12-27-22(31)17(25)10-15-11-26-18-9-7-6-8-16(15)18/h6-9,11,13-14,17,20-21,26H,5,10,12,25H2,1-4H3,(H,27,31)(H,28,30)(H,29,32)(H,33,34) |
| InChIKey | VPWCONAURDZFST-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 166.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |