About N-thiophen-2-ylcarbamate
N-thiophen-2-ylcarbamate (PubChem CID 19956166) has the molecular formula C5H4NO2S-
and a molecular weight of 142.16 g/mol. Its IUPAC name is N-thiophen-2-ylcarbamate.
Molecular Properties
| Compound Name | N-thiophen-2-ylcarbamate |
| PubChem CID | 19956166 |
| Molecular Formula | C5H4NO2S- |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.00 |
| IUPAC Name | N-thiophen-2-ylcarbamate |
| SMILES | O=C([O-])Nc1cccs1 |
| InChI | InChI=1S/C5H5NO2S/c7-5(8)6-4-2-1-3-9-4/h1-3,6H,(H,7,8)/p-1 |
| InChIKey | VNMLVHLVBFHHSN-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-thiophen-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-thiophen-2-ylcarbamate?
The IUPAC name of N-thiophen-2-ylcarbamate (CID 19956166) is N-thiophen-2-ylcarbamate.
What is the SMILES notation for N-thiophen-2-ylcarbamate?
The canonical SMILES for N-thiophen-2-ylcarbamate is O=C([O-])Nc1cccs1.
What is the InChIKey of N-thiophen-2-ylcarbamate?
The InChIKey is VNMLVHLVBFHHSN-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5NO2S/c7-5(8)6-4-2-1-3-9-4/h1-3,6H,(H,7,8)/p-1.
What are the key properties of N-thiophen-2-ylcarbamate?
N-thiophen-2-ylcarbamate has a molecular weight of 142.16 g/mol, XLogP of 0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-thiophen-2-ylcarbamate is sourced from PubChem (CID 19956166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).