About CID 162245041
CID 162245041 (PubChem CID 162245041) has the molecular formula C16H20N2NaO4S2
and a molecular weight of 391.47 g/mol.
Molecular Properties
| Compound Name | CID 162245041 |
| PubChem CID | 162245041 |
| Molecular Formula | C16H20N2NaO4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | — |
| SMILES | O=C(Nc1cccs1)OCCCCCCOC(=O)Nc1cccs1.[Na] |
| InChI | InChI=1S/C16H20N2O4S2.Na/c19-15(17-13-7-5-11-23-13)21-9-3-1-2-4-10-22-16(20)18-14-8-6-12-24-14;/h5-8,11-12H,1-4,9-10H2,(H,17,19)(H,18,20); |
| InChIKey | ZXFJAMXEWHABRA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 162245041 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162245041?
The IUPAC name of CID 162245041 (CID 162245041) is not available.
What is the SMILES notation for CID 162245041?
The canonical SMILES for CID 162245041 is O=C(Nc1cccs1)OCCCCCCOC(=O)Nc1cccs1.[Na].
What is the InChIKey of CID 162245041?
The InChIKey is ZXFJAMXEWHABRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O4S2.Na/c19-15(17-13-7-5-11-23-13)21-9-3-1-2-4-10-22-16(20)18-14-8-6-12-24-14;/h5-8,11-12H,1-4,9-10H2,(H,17,19)(H,18,20);.
What are the key properties of CID 162245041?
CID 162245041 has a molecular weight of 391.47 g/mol, XLogP of 4.79, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162245041 is sourced from PubChem (CID 162245041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).