C13H13NO5S2 — CID 57136323
[4-(thiophen-2-ylcarbamoyloxymethyl)phenyl] methanesulfonate (PubChem CID 57136323) has the molecular formula C13H13NO5S2 and a molecular weight of 327.38 g/mol. Its IUPAC name is [4-(thiophen-2-ylcarbamoyloxymethyl)phenyl] methanesulfonate.
| Compound Name | [4-(thiophen-2-ylcarbamoyloxymethyl)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 57136323 |
| Molecular Formula | C13H13NO5S2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | [4-(thiophen-2-ylcarbamoyloxymethyl)phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(COC(=O)Nc2cccs2)cc1 |
| InChI | InChI=1S/C13H13NO5S2/c1-21(16,17)19-11-6-4-10(5-7-11)9-18-13(15)14-12-3-2-8-20-12/h2-8H,9H2,1H3,(H,14,15) |
| InChIKey | RMKJCVUDRHRLPF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|