About sodium N-thiophen-2-ylcarbamate
sodium N-thiophen-2-ylcarbamate (PubChem CID 70473734) has the molecular formula C5H4NNaO2S
and a molecular weight of 165.15 g/mol. Its IUPAC name is sodium N-thiophen-2-ylcarbamate.
Molecular Properties
| Compound Name | sodium N-thiophen-2-ylcarbamate |
| PubChem CID | 70473734 |
| Molecular Formula | C5H4NNaO2S |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 164.99 |
| IUPAC Name | sodium N-thiophen-2-ylcarbamate |
| SMILES | O=C([O-])Nc1cccs1.[Na+] |
| InChI | InChI=1S/C5H5NO2S.Na/c7-5(8)6-4-2-1-3-9-4;/h1-3,6H,(H,7,8);/q;+1/p-1 |
| InChIKey | LTDFZBVGZMWLEC-UHFFFAOYSA-M |
| XLogP | -2.49 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium N-thiophen-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-thiophen-2-ylcarbamate?
The IUPAC name of sodium N-thiophen-2-ylcarbamate (CID 70473734) is sodium N-thiophen-2-ylcarbamate.
What is the SMILES notation for sodium N-thiophen-2-ylcarbamate?
The canonical SMILES for sodium N-thiophen-2-ylcarbamate is O=C([O-])Nc1cccs1.[Na+].
What is the InChIKey of sodium N-thiophen-2-ylcarbamate?
The InChIKey is LTDFZBVGZMWLEC-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5NO2S.Na/c7-5(8)6-4-2-1-3-9-4;/h1-3,6H,(H,7,8);/q;+1/p-1.
What are the key properties of sodium N-thiophen-2-ylcarbamate?
sodium N-thiophen-2-ylcarbamate has a molecular weight of 165.15 g/mol, XLogP of -2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-thiophen-2-ylcarbamate is sourced from PubChem (CID 70473734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).