C14H13BrO4S — CID 19956572
4-(bromomethyl)-3-phenylmethoxybenzenesulfonic acid (PubChem CID 19956572) has the molecular formula C14H13BrO4S and a molecular weight of 357.23 g/mol. Its IUPAC name is 4-(bromomethyl)-3-phenylmethoxybenzenesulfonic acid.
| Compound Name | 4-(bromomethyl)-3-phenylmethoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 19956572 |
| Molecular Formula | C14H13BrO4S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 4-(bromomethyl)-3-phenylmethoxybenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(CBr)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C14H13BrO4S/c15-9-12-6-7-13(20(16,17)18)8-14(12)19-10-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,16,17,18) |
| InChIKey | AVUJLBNPQSZDIO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|