2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid

C8H11F3N2O3 — CID 19957016

IUPAC2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid
SMILESC=CCC(NC(=O)C(F)(F)F)C(N)C(=O)O
InChIInChI=1S/C8H11F3N2O3/c1-2-3-4(5(12)6(14)15)13-7(16)8(9,10)11/h2,4-5H,1,3,12H2,(H,13,16)(H,14,15)
InChIKeyIZPPMMVHOPMYSZ-UHFFFAOYSA-N
MW240.18 g/mol
LogP0.02
Rot. Bonds5

About 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid

2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid (PubChem CID 19957016) has the molecular formula C8H11F3N2O3 and a molecular weight of 240.18 g/mol. Its IUPAC name is 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid.

Molecular Properties

Compound Name2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid
PubChem CID19957016
Molecular FormulaC8H11F3N2O3
Molecular Weight240.18 g/mol
Exact Mass240.07
IUPAC Name2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid
SMILESC=CCC(NC(=O)C(F)(F)F)C(N)C(=O)O
InChIInChI=1S/C8H11F3N2O3/c1-2-3-4(5(12)6(14)15)13-7(16)8(9,10)11/h2,4-5H,1,3,12H2,(H,13,16)(H,14,15)
InChIKeyIZPPMMVHOPMYSZ-UHFFFAOYSA-N
XLogP0.02
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.18
LogP ≤ 50.02
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid?
The IUPAC name of 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid (CID 19957016) is 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid.
What is the SMILES notation for 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid?
The canonical SMILES for 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid is C=CCC(NC(=O)C(F)(F)F)C(N)C(=O)O.
What is the InChIKey of 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid?
The InChIKey is IZPPMMVHOPMYSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N2O3/c1-2-3-4(5(12)6(14)15)13-7(16)8(9,10)11/h2,4-5H,1,3,12H2,(H,13,16)(H,14,15).
What are the key properties of 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid?
2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid has a molecular weight of 240.18 g/mol, XLogP of 0.02, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid is sourced from PubChem (CID 19957016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).