C8H11F3N2O3 — CID 19957016
2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid (PubChem CID 19957016) has the molecular formula C8H11F3N2O3 and a molecular weight of 240.18 g/mol. Its IUPAC name is 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid.
| Compound Name | 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid |
|---|---|
| PubChem CID | 19957016 |
| Molecular Formula | C8H11F3N2O3 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoic acid |
| SMILES | C=CCC(NC(=O)C(F)(F)F)C(N)C(=O)O |
| InChI | InChI=1S/C8H11F3N2O3/c1-2-3-4(5(12)6(14)15)13-7(16)8(9,10)11/h2,4-5H,1,3,12H2,(H,13,16)(H,14,15) |
| InChIKey | IZPPMMVHOPMYSZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|