C9H13F3N2O3 — CID 140974698
methyl (2S)-2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoate (PubChem CID 140974698) has the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoate.
| Compound Name | methyl (2S)-2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoate |
|---|---|
| PubChem CID | 140974698 |
| Molecular Formula | C9H13F3N2O3 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | methyl (2S)-2-amino-3-[(2,2,2-trifluoroacetyl)amino]hex-5-enoate |
| SMILES | C=CCC(NC(=O)C(F)(F)F)[C@H](N)C(=O)OC |
| InChI | InChI=1S/C9H13F3N2O3/c1-3-4-5(6(13)7(15)17-2)14-8(16)9(10,11)12/h3,5-6H,1,4,13H2,2H3,(H,14,16)/t5?,6-/m0/s1 |
| InChIKey | OAXOZDYXBDZWJI-GDVGLLTNSA-N |
| XLogP | 0.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|