C18H30N4O2 — CID 19962926
1-[3-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]propyl]-3-propan-2-ylurea (PubChem CID 19962926) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[3-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]propyl]-3-propan-2-ylurea.
| Compound Name | 1-[3-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]propyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 19962926 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 1-[3-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]propyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCCCOc1cc(CN2CCCCC2)ccn1 |
| InChI | InChI=1S/C18H30N4O2/c1-15(2)21-18(23)20-8-6-12-24-17-13-16(7-9-19-17)14-22-10-4-3-5-11-22/h7,9,13,15H,3-6,8,10-12,14H2,1-2H3,(H2,20,21,23) |
| InChIKey | YPMVIOUQGGYGMV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|