C16H24N6OS — CID 13313699
3-N-[3-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]propyl]-1,2,5-thiadiazole-3,4-diamine (PubChem CID 13313699) has the molecular formula C16H24N6OS and a molecular weight of 348.48 g/mol. Its IUPAC name is 3-N-[3-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]propyl]-1,2,5-thiadiazole-3,4-diamine.
| Compound Name | 3-N-[3-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]propyl]-1,2,5-thiadiazole-3,4-diamine |
|---|---|
| PubChem CID | 13313699 |
| Molecular Formula | C16H24N6OS |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 3-N-[3-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]propyl]-1,2,5-thiadiazole-3,4-diamine |
| SMILES | Nc1nsnc1NCCCOc1cc(CN2CCCCC2)ccn1 |
| InChI | InChI=1S/C16H24N6OS/c17-15-16(21-24-20-15)19-6-4-10-23-14-11-13(5-7-18-14)12-22-8-2-1-3-9-22/h5,7,11H,1-4,6,8-10,12H2,(H2,17,20)(H,19,21) |
| InChIKey | FTQNYNLEKXCHPJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|