C16H23N5S2 — CID 154410810
3-N-[3-[3-(pyrrolidin-1-ylmethyl)phenyl]sulfanylpropyl]-1,2,5-thiadiazole-3,4-diamine (PubChem CID 154410810) has the molecular formula C16H23N5S2 and a molecular weight of 349.53 g/mol. Its IUPAC name is 3-N-[3-[3-(pyrrolidin-1-ylmethyl)phenyl]sulfanylpropyl]-1,2,5-thiadiazole-3,4-diamine.
| Compound Name | 3-N-[3-[3-(pyrrolidin-1-ylmethyl)phenyl]sulfanylpropyl]-1,2,5-thiadiazole-3,4-diamine |
|---|---|
| PubChem CID | 154410810 |
| Molecular Formula | C16H23N5S2 |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-N-[3-[3-(pyrrolidin-1-ylmethyl)phenyl]sulfanylpropyl]-1,2,5-thiadiazole-3,4-diamine |
| SMILES | Nc1nsnc1NCCCSc1cccc(CN2CCCC2)c1 |
| InChI | InChI=1S/C16H23N5S2/c17-15-16(20-23-19-15)18-7-4-10-22-14-6-3-5-13(11-14)12-21-8-1-2-9-21/h3,5-6,11H,1-2,4,7-10,12H2,(H2,17,19)(H,18,20) |
| InChIKey | AVFWSRPBBZUMQK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|