About 3-chloro-2-iodothiophene
3-chloro-2-iodothiophene (PubChem CID 19963271) has the molecular formula C4H2ClIS
and a molecular weight of 244.48 g/mol. Its IUPAC name is 3-chloro-2-iodothiophene.
Molecular Properties
| Compound Name | 3-chloro-2-iodothiophene |
| PubChem CID | 19963271 |
| Molecular Formula | C4H2ClIS |
| Molecular Weight | 244.48 g/mol |
| Exact Mass | 243.86 |
| IUPAC Name | 3-chloro-2-iodothiophene |
| SMILES | Clc1ccsc1I |
| InChI | InChI=1S/C4H2ClIS/c5-3-1-2-7-4(3)6/h1-2H |
| InChIKey | VZKNBCJDVLLTCL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-iodothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-iodothiophene?
The IUPAC name of 3-chloro-2-iodothiophene (CID 19963271) is 3-chloro-2-iodothiophene.
What is the SMILES notation for 3-chloro-2-iodothiophene?
The canonical SMILES for 3-chloro-2-iodothiophene is Clc1ccsc1I.
What is the InChIKey of 3-chloro-2-iodothiophene?
The InChIKey is VZKNBCJDVLLTCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2ClIS/c5-3-1-2-7-4(3)6/h1-2H.
What are the key properties of 3-chloro-2-iodothiophene?
3-chloro-2-iodothiophene has a molecular weight of 244.48 g/mol, XLogP of 3.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-iodothiophene is sourced from PubChem (CID 19963271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).