About 2,3-diiodothiophene
2,3-diiodothiophene (PubChem CID 630668) has the molecular formula C4H2I2S
and a molecular weight of 335.94 g/mol. Its IUPAC name is 2,3-diiodothiophene.
Molecular Properties
| Compound Name | 2,3-diiodothiophene |
| PubChem CID | 630668 |
| Molecular Formula | C4H2I2S |
| Molecular Weight | 335.94 g/mol |
| Exact Mass | 335.80 |
| IUPAC Name | 2,3-diiodothiophene |
| SMILES | Ic1ccsc1I |
| InChI | InChI=1S/C4H2I2S/c5-3-1-2-7-4(3)6/h1-2H |
| InChIKey | BUXDZKJHNFMYJT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.94 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diiodothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diiodothiophene?
The IUPAC name of 2,3-diiodothiophene (CID 630668) is 2,3-diiodothiophene.
What is the SMILES notation for 2,3-diiodothiophene?
The canonical SMILES for 2,3-diiodothiophene is Ic1ccsc1I.
What is the InChIKey of 2,3-diiodothiophene?
The InChIKey is BUXDZKJHNFMYJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2I2S/c5-3-1-2-7-4(3)6/h1-2H.
What are the key properties of 2,3-diiodothiophene?
2,3-diiodothiophene has a molecular weight of 335.94 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diiodothiophene is sourced from PubChem (CID 630668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).