C8H7IN2S2 — CID 130914169
(3-iodothiophen-2-yl)-(1,2-thiazol-5-yl)methanamine (PubChem CID 130914169) has the molecular formula C8H7IN2S2 and a molecular weight of 322.20 g/mol. Its IUPAC name is (3-iodothiophen-2-yl)-(1,2-thiazol-5-yl)methanamine.
| Compound Name | (3-iodothiophen-2-yl)-(1,2-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 130914169 |
| Molecular Formula | C8H7IN2S2 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.91 |
| IUPAC Name | (3-iodothiophen-2-yl)-(1,2-thiazol-5-yl)methanamine |
| SMILES | NC(c1ccns1)c1sccc1I |
| InChI | InChI=1S/C8H7IN2S2/c9-5-2-4-12-8(5)7(10)6-1-3-11-13-6/h1-4,7H,10H2 |
| InChIKey | CQTHXTOTXNVCCQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|