C8H7ClN2OS — CID 131015361
(2-chlorofuran-3-yl)-(1,2-thiazol-5-yl)methanamine (PubChem CID 131015361) has the molecular formula C8H7ClN2OS and a molecular weight of 214.68 g/mol. Its IUPAC name is (2-chlorofuran-3-yl)-(1,2-thiazol-5-yl)methanamine.
| Compound Name | (2-chlorofuran-3-yl)-(1,2-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 131015361 |
| Molecular Formula | C8H7ClN2OS |
| Molecular Weight | 214.68 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | (2-chlorofuran-3-yl)-(1,2-thiazol-5-yl)methanamine |
| SMILES | NC(c1ccns1)c1ccoc1Cl |
| InChI | InChI=1S/C8H7ClN2OS/c9-8-5(2-4-12-8)7(10)6-1-3-11-13-6/h1-4,7H,10H2 |
| InChIKey | DNRKZQSEKYRHSI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |