C8H7BrN2OS — CID 130855940
(5-bromofuran-3-yl)-(1,2-thiazol-5-yl)methanamine (PubChem CID 130855940) has the molecular formula C8H7BrN2OS and a molecular weight of 259.13 g/mol. Its IUPAC name is (5-bromofuran-3-yl)-(1,2-thiazol-5-yl)methanamine.
| Compound Name | (5-bromofuran-3-yl)-(1,2-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 130855940 |
| Molecular Formula | C8H7BrN2OS |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 257.95 |
| IUPAC Name | (5-bromofuran-3-yl)-(1,2-thiazol-5-yl)methanamine |
| SMILES | NC(c1coc(Br)c1)c1ccns1 |
| InChI | InChI=1S/C8H7BrN2OS/c9-7-3-5(4-12-7)8(10)6-1-2-11-13-6/h1-4,8H,10H2 |
| InChIKey | MGADXWBLFIZNPS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |