C9H4Cl4S2 — CID 80642391
2,5-dichloro-3-[chloro-(3-chlorothiophen-2-yl)methyl]thiophene (PubChem CID 80642391) has the molecular formula C9H4Cl4S2 and a molecular weight of 318.08 g/mol. Its IUPAC name is 2,5-dichloro-3-[chloro-(3-chlorothiophen-2-yl)methyl]thiophene.
| Compound Name | 2,5-dichloro-3-[chloro-(3-chlorothiophen-2-yl)methyl]thiophene |
|---|---|
| PubChem CID | 80642391 |
| Molecular Formula | C9H4Cl4S2 |
| Molecular Weight | 318.08 g/mol |
| Exact Mass | 315.85 |
| IUPAC Name | 2,5-dichloro-3-[chloro-(3-chlorothiophen-2-yl)methyl]thiophene |
| SMILES | Clc1cc(C(Cl)c2sccc2Cl)c(Cl)s1 |
| InChI | InChI=1S/C9H4Cl4S2/c10-5-1-2-14-8(5)7(12)4-3-6(11)15-9(4)13/h1-3,7H |
| InChIKey | XFXPWUGGMVDRNO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.08 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|