C28H31FN2O3S2 — CID 19963655
N-[2-[6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptan-3-yl]ethyl]benzenecarbothioamide;4-methylbenzenesulfonic acid (PubChem CID 19963655) has the molecular formula C28H31FN2O3S2 and a molecular weight of 526.70 g/mol. Its IUPAC name is N-[2-[6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptan-3-yl]ethyl]benzenecarbothioamide;4-methylbenzenesulfonic acid.
| Compound Name | N-[2-[6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptan-3-yl]ethyl]benzenecarbothioamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 19963655 |
| Molecular Formula | C28H31FN2O3S2 |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | N-[2-[6-(4-fluorophenyl)-3-azabicyclo[3.2.0]heptan-3-yl]ethyl]benzenecarbothioamide;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Fc1ccc(C2CC3CN(CCNC(=S)c4ccccc4)CC32)cc1 |
| InChI | InChI=1S/C21H23FN2S.C7H8O3S/c22-18-8-6-15(7-9-18)19-12-17-13-24(14-20(17)19)11-10-23-21(25)16-4-2-1-3-5-16;1-6-2-4-7(5-3-6)11(8,9)10/h1-9,17,19-20H,10-14H2,(H,23,25);2-5H,1H3,(H,8,9,10) |
| InChIKey | ZENVYHHKALGHQG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|